Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, Safety of Homovanillic Acid, 306-08-1, Name is Homovanillic Acid, SMILES is O=C(O)CC1=CC=C(O)C(OC)=C1, belongs to indole-building-block compound. In a document, author is Liu, Jianming, introduce the new discover.
Elemental sulfur accelerated the reactivity of the 3-position of indole for the construction of chromeno[2,3-b]indoles
An intermolecular cross-cyclization between salicylaldehydes and indoles for the preparation of chromeno[2,3-b]indole derivatives was successfully developed by using elemental sulfur as the promoter and oxidant. Various chromeno[2,3-b]indoles can be prepared using indoles and salicylaldehydes bearing different functional groups. The preliminary mechanistic investigations demonstrated that elemental sulfur not only acted as an additional oxidant but also facilitated the reactivity of the 3-position of indole.
A reaction mechanism is the microscopic path by which reactants are transformed into products. Each step is an elementary reaction. In my other articles, you can also check out more blogs about 306-08-1. Safety of Homovanillic Acid.
Reference:
Indole alkaloid derivatives as building blocks of natural products from?Bacillus thuringiensis?and?Bacillus velezensis?and their antibacterial and antifungal activity study,
,Preparation of Indole Containing Building Blocks for the Regiospecific Construction of Indole Appended Pyrazoles and Pyrroles