Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, Recommanded Product: 190786-44-8, 190786-44-8, Name is Bepotastine besilate, SMILES is O=C(O)CCCN1CCC(O[C@@H](C2=CC=C(Cl)C=C2)C3=NC=CC=C3)CC1.O=S(C4=CC=CC=C4)(O)=O, belongs to indole-building-block compound. In a document, author is Ma, Shiqiang, introduce the new discover.
Synthesis of 2,3-disubstituted indoles via a tandem reaction
A strategy for the synthesis of 2,3-disubstituted indoles from 2-allyl-2-(2-nitrophenyl)cyclohexane-1,3-dione has been developed. A wide array of 2,3-disubstituted indoles were accessed in modest to good yieldsviaa tandem reduction/condensation/fragmentation/cyclization sequence. The utility of this strategy was exemplified in the formal syntheses of leucomidine A and goniomitine. The mechanism was confirmed by experiments and density functional theory (DFT) calculations. Differential fragmentation made the reaction more complicated.
A reaction mechanism is the microscopic path by which reactants are transformed into products. Each step is an elementary reaction. In my other articles, you can also check out more blogs about 190786-44-8. Recommanded Product: 190786-44-8.
Reference:
Indole alkaloid derivatives as building blocks of natural products from?Bacillus thuringiensis?and?Bacillus velezensis?and their antibacterial and antifungal activity study,
,Preparation of Indole Containing Building Blocks for the Regiospecific Construction of Indole Appended Pyrazoles and Pyrroles